C25H37O3PS — CID 138319759
(3S)-3-tert-butyl-4-[2,6-dimethoxy-3,5-di(propan-2-yl)phenyl]-2H-1,3-benzoxaphosphole;sulfane (PubChem CID 138319759) has the molecular formula C25H37O3PS and a molecular weight of 448.61 g/mol. Its IUPAC name is (3S)-3-tert-butyl-4-[2,6-dimethoxy-3,5-di(propan-2-yl)phenyl]-2H-1,3-benzoxaphosphole;sulfane.
| Compound Name | (3S)-3-tert-butyl-4-[2,6-dimethoxy-3,5-di(propan-2-yl)phenyl]-2H-1,3-benzoxaphosphole;sulfane |
|---|---|
| PubChem CID | 138319759 |
| Molecular Formula | C25H37O3PS |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (3S)-3-tert-butyl-4-[2,6-dimethoxy-3,5-di(propan-2-yl)phenyl]-2H-1,3-benzoxaphosphole;sulfane |
| SMILES | COc1c(C(C)C)cc(C(C)C)c(OC)c1-c1cccc2c1[P@](C(C)(C)C)CO2.S |
| InChI | InChI=1S/C25H35O3P.H2S/c1-15(2)18-13-19(16(3)4)23(27-9)21(22(18)26-8)17-11-10-12-20-24(17)29(14-28-20)25(5,6)7;/h10-13,15-16H,14H2,1-9H3;1H2/t29-;/m1./s1 |
| InChIKey | QUXKMKSFMXQWDU-XXIQNXCHSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|