C12H8N2O5S — CID 1383563
4-[[(2Z)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]benzoic acid (PubChem CID 1383563) has the molecular formula C12H8N2O5S and a molecular weight of 292.27 g/mol. Its IUPAC name is 4-[[(2Z)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]benzoic acid.
| Compound Name | 4-[[(2Z)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1383563 |
| Molecular Formula | C12H8N2O5S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 4-[[(2Z)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]benzoic acid |
| SMILES | O=C(/C=C1\SC(=O)NC1=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H8N2O5S/c15-9(5-8-10(16)14-12(19)20-8)13-7-3-1-6(2-4-7)11(17)18/h1-5H,(H,13,15)(H,17,18)(H,14,16,19)/b8-5- |
| InChIKey | VGLNHNGALQXYTO-YVMONPNESA-N |
| XLogP | 1.19 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|