C13H14N2O3S2 — CID 138373854
2-(3-nitrobenzoyl)prop-2-enyl N,N-dimethylcarbamodithioate (PubChem CID 138373854) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-(3-nitrobenzoyl)prop-2-enyl N,N-dimethylcarbamodithioate.
| Compound Name | 2-(3-nitrobenzoyl)prop-2-enyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 138373854 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(3-nitrobenzoyl)prop-2-enyl N,N-dimethylcarbamodithioate |
| SMILES | C=C(CSC(=S)N(C)C)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-9(8-20-13(19)14(2)3)12(16)10-5-4-6-11(7-10)15(17)18/h4-7H,1,8H2,2-3H3 |
| InChIKey | DJAIWCKIQPRHDR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|