C18H10N4O — CID 138373926
2-oxo-4-phenyl-1,3-dihydroimidazo[1,2-a]indole-6,7-dicarbonitrile (PubChem CID 138373926) has the molecular formula C18H10N4O and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-oxo-4-phenyl-1,3-dihydroimidazo[1,2-a]indole-6,7-dicarbonitrile.
| Compound Name | 2-oxo-4-phenyl-1,3-dihydroimidazo[1,2-a]indole-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 138373926 |
| Molecular Formula | C18H10N4O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-oxo-4-phenyl-1,3-dihydroimidazo[1,2-a]indole-6,7-dicarbonitrile |
| SMILES | N#Cc1cc2c(-c3ccccc3)c3n(c2cc1C#N)CC(=O)N3 |
| InChI | InChI=1S/C18H10N4O/c19-8-12-6-14-15(7-13(12)9-20)22-10-16(23)21-18(22)17(14)11-4-2-1-3-5-11/h1-7H,10H2,(H,21,23) |
| InChIKey | VKINURIAALHUSD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |