About 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one
6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one (PubChem CID 138374025) has the molecular formula C22H21BrO4
and a molecular weight of 429.31 g/mol. Its IUPAC name is 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one.
Molecular Properties
| Compound Name | 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one |
| PubChem CID | 138374025 |
| Molecular Formula | C22H21BrO4 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one |
| SMILES | COc1ccc(C(=O)CC2c3cc(Br)ccc3OC(=O)C23CCCC3)cc1 |
| InChI | InChI=1S/C22H21BrO4/c1-26-16-7-4-14(5-8-16)19(24)13-18-17-12-15(23)6-9-20(17)27-21(25)22(18)10-2-3-11-22/h4-9,12,18H,2-3,10-11,13H2,1H3 |
| InChIKey | NCEYVXAAHGSQEV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one?
The IUPAC name of 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one (CID 138374025) is 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one.
What is the SMILES notation for 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one?
The canonical SMILES for 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one is COc1ccc(C(=O)CC2c3cc(Br)ccc3OC(=O)C23CCCC3)cc1.
What is the InChIKey of 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one?
The InChIKey is NCEYVXAAHGSQEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BrO4/c1-26-16-7-4-14(5-8-16)19(24)13-18-17-12-15(23)6-9-20(17)27-21(25)22(18)10-2-3-11-22/h4-9,12,18H,2-3,10-11,13H2,1H3.
What are the key properties of 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one?
6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one has a molecular weight of 429.31 g/mol, XLogP of 5.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-[2-(4-methoxyphenyl)-2-oxoethyl]spiro[4H-chromene-3,1'-cyclopentane]-2-one is sourced from PubChem (CID 138374025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).