C24H24N4OS — CID 138374069
4,6-dimethyl-3-[3-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]butyl]-1H-quinolin-2-one (PubChem CID 138374069) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 4,6-dimethyl-3-[3-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]butyl]-1H-quinolin-2-one.
| Compound Name | 4,6-dimethyl-3-[3-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]butyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 138374069 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4,6-dimethyl-3-[3-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]butyl]-1H-quinolin-2-one |
| SMILES | CC(CCc1c(C)c2cc(C)ccc2[nH]c1=O)=NNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H24N4OS/c1-15-9-12-21-20(13-15)17(3)19(23(29)25-21)11-10-16(2)27-28-24-26-22(14-30-24)18-7-5-4-6-8-18/h4-9,12-14H,10-11H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | BHZMMFUPQGHZNQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|