C23H23N4O2+ — CID 138374205
6-[(E)-3-[(3aR,6aS)-5-phenyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-2-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 138374205) has the molecular formula C23H23N4O2+ and a molecular weight of 387.46 g/mol. Its IUPAC name is 6-[(E)-3-[(3aR,6aS)-5-phenyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-2-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[(E)-3-[(3aR,6aS)-5-phenyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-2-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 138374205 |
| Molecular Formula | C23H23N4O2+ |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 6-[(E)-3-[(3aR,6aS)-5-phenyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-ium-2-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(/C=C/C(=O)N3C[C@H]4C[N+](c5ccccc5)=C[C@H]4C3)cnc2N1 |
| InChI | InChI=1S/C23H22N4O2/c28-21-8-7-17-10-16(11-24-23(17)25-21)6-9-22(29)27-14-18-12-26(13-19(18)15-27)20-4-2-1-3-5-20/h1-6,9-12,18-19H,7-8,13-15H2/p+1/t18-,19+/m0/s1 |
| InChIKey | OBGRXVFFXROYMX-RBUKOAKNSA-O |
| XLogP | 2.48 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|