C28H31N3O3 — CID 138374620
(2S,4S)-1-(2,2-diphenylacetyl)-4-(3-pyridin-3-ylbutylamino)pyrrolidine-2-carboxylic acid (PubChem CID 138374620) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is (2S,4S)-1-(2,2-diphenylacetyl)-4-(3-pyridin-3-ylbutylamino)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(2,2-diphenylacetyl)-4-(3-pyridin-3-ylbutylamino)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 138374620 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (2S,4S)-1-(2,2-diphenylacetyl)-4-(3-pyridin-3-ylbutylamino)pyrrolidine-2-carboxylic acid |
| SMILES | CC(CCN[C@H]1C[C@@H](C(=O)O)N(C(=O)C(c2ccccc2)c2ccccc2)C1)c1cccnc1 |
| InChI | InChI=1S/C28H31N3O3/c1-20(23-13-8-15-29-18-23)14-16-30-24-17-25(28(33)34)31(19-24)27(32)26(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-13,15,18,20,24-26,30H,14,16-17,19H2,1H3,(H,33,34)/t20?,24-,25-/m0/s1 |
| InChIKey | FHWGVVZIYMGQNR-PTOFZMKOSA-N |
| XLogP | 4.05 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |