C26H30FN7O2 — CID 138374930
4-[[4-fluoro-3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one (PubChem CID 138374930) has the molecular formula C26H30FN7O2 and a molecular weight of 491.57 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 138374930 |
| Molecular Formula | C26H30FN7O2 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 4-[[4-fluoro-3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]phenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
| SMILES | O=C1NNC(Cc2ccc(F)c(C(=O)N3CCN(c4cnc5nc[nH]c5c4)CC3)c2)C2CCCCC12 |
| InChI | InChI=1S/C26H30FN7O2/c27-21-6-5-16(12-22-18-3-1-2-4-19(18)25(35)32-31-22)11-20(21)26(36)34-9-7-33(8-10-34)17-13-23-24(28-14-17)30-15-29-23/h5-6,11,13-15,18-19,22,31H,1-4,7-10,12H2,(H,32,35)(H,28,29,30) |
| InChIKey | ABNOTDYLUGKKET-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |