C27H33N7O3 — CID 138374944
4-[[3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]-4-methoxyphenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one (PubChem CID 138374944) has the molecular formula C27H33N7O3 and a molecular weight of 503.61 g/mol. Its IUPAC name is 4-[[3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]-4-methoxyphenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]-4-methoxyphenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 138374944 |
| Molecular Formula | C27H33N7O3 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 4-[[3-[4-(1H-imidazo[4,5-b]pyridin-6-yl)piperazine-1-carbonyl]-4-methoxyphenyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
| SMILES | COc1ccc(CC2NNC(=O)C3CCCCC23)cc1C(=O)N1CCN(c2cnc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C27H33N7O3/c1-37-24-7-6-17(13-22-19-4-2-3-5-20(19)26(35)32-31-22)12-21(24)27(36)34-10-8-33(9-11-34)18-14-23-25(28-15-18)30-16-29-23/h6-7,12,14-16,19-20,22,31H,2-5,8-11,13H2,1H3,(H,32,35)(H,28,29,30) |
| InChIKey | PKYVBYASQLHMJV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |