C14H16F8N4O2S — CID 138375154
6-hydroxy-1-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 138375154) has the molecular formula C14H16F8N4O2S and a molecular weight of 456.36 g/mol. Its IUPAC name is 6-hydroxy-1-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-hydroxy-1-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138375154 |
| Molecular Formula | C14H16F8N4O2S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 6-hydroxy-1-[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]ethyl]-3-(trifluoromethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | CC(c1ccc(S(F)(F)(F)(F)F)cc1)N1NC(C(F)(F)F)C2C(=O)NC(O)NC21 |
| InChI | InChI=1S/C14H16F8N4O2S/c1-6(7-2-4-8(5-3-7)29(18,19,20,21)22)26-11-9(10(25-26)14(15,16)17)12(27)24-13(28)23-11/h2-6,9-11,13,23,25,28H,1H3,(H,24,27) |
| InChIKey | TXKXGQLJXVJJTR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |