C21H29N5O3 — CID 138375296
6-[(E)-but-2-enyl]-2-methyl-4-[2-(morpholine-4-carbonyl)pyrimidin-5-yl]-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 138375296) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 6-[(E)-but-2-enyl]-2-methyl-4-[2-(morpholine-4-carbonyl)pyrimidin-5-yl]-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 6-[(E)-but-2-enyl]-2-methyl-4-[2-(morpholine-4-carbonyl)pyrimidin-5-yl]-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 138375296 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 6-[(E)-but-2-enyl]-2-methyl-4-[2-(morpholine-4-carbonyl)pyrimidin-5-yl]-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | C/C=C/CN1CC(c2cnc(C(=O)N3CCOCC3)nc2)C2CC(C)NC2C1=O |
| InChI | InChI=1S/C21H29N5O3/c1-3-4-5-26-13-17(16-10-14(2)24-18(16)20(26)27)15-11-22-19(23-12-15)21(28)25-6-8-29-9-7-25/h3-4,11-12,14,16-18,24H,5-10,13H2,1-2H3/b4-3+ |
| InChIKey | XQVIKNNAEVAXEL-ONEGZZNKSA-N |
| XLogP | 0.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|