About (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane
(2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane (PubChem CID 138375836) has the molecular formula C13H19BrF2OSi
and a molecular weight of 337.28 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane |
| PubChem CID | 138375836 |
| Molecular Formula | C13H19BrF2OSi |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C13H19BrF2OSi/c1-13(2,3)18(4,5)17-8-9-6-7-10(15)12(16)11(9)14/h6-7H,8H2,1-5H3 |
| InChIKey | FNIIYVLCFSUMCL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane?
The IUPAC name of (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane (CID 138375836) is (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane?
The canonical SMILES for (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)OCc1ccc(F)c(F)c1Br.
What is the InChIKey of (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane?
The InChIKey is FNIIYVLCFSUMCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrF2OSi/c1-13(2,3)18(4,5)17-8-9-6-7-10(15)12(16)11(9)14/h6-7H,8H2,1-5H3.
What are the key properties of (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane?
(2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane has a molecular weight of 337.28 g/mol, XLogP of 5.25, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-3,4-difluorophenyl)methoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 138375836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).