C19H30N2O4 — CID 138376560
tert-butyl (2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoate (PubChem CID 138376560) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl (2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 138376560 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl (2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoate |
| SMILES | CC/C=C\C/C=C\C=C\C(=O)N[C@@H](CCC(N)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O4/c1-5-6-7-8-9-10-11-12-17(23)21-15(13-14-16(20)22)18(24)25-19(2,3)4/h6-7,9-12,15H,5,8,13-14H2,1-4H3,(H2,20,22)(H,21,23)/b7-6-,10-9-,12-11+/t15-/m0/s1 |
| InChIKey | NCCNAYBSYRZTTG-BWVORKDGSA-N |
| XLogP | 2.55 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|