C15H22N2O4 — CID 138376561
(2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoic acid (PubChem CID 138376561) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 138376561 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2S)-5-amino-2-[[(2E,4Z,7Z)-deca-2,4,7-trienoyl]amino]-5-oxopentanoic acid |
| SMILES | CC/C=C\C/C=C\C=C\C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C15H22N2O4/c1-2-3-4-5-6-7-8-9-14(19)17-12(15(20)21)10-11-13(16)18/h3-4,6-9,12H,2,5,10-11H2,1H3,(H2,16,18)(H,17,19)(H,20,21)/b4-3-,7-6-,9-8+/t12-/m0/s1 |
| InChIKey | MFDQKHCMUMALFO-QCDNFJNUSA-N |
| XLogP | 1.29 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|