About (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one
(5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one (PubChem CID 138376730) has the molecular formula C15H9N3O2S2
and a molecular weight of 327.39 g/mol. Its IUPAC name is (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one |
| PubChem CID | 138376730 |
| Molecular Formula | C15H9N3O2S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)S\C1=C/c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C15H9N3O2S2/c16-13-12(22-15(19)18-13)7-8-5-6-10(20-8)14-17-9-3-1-2-4-11(9)21-14/h1-7H,(H2,16,18,19)/b12-7- |
| InChIKey | RTBWHMVFOMMXTE-GHXNOFRVSA-N |
| XLogP | 4.33 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one?
The IUPAC name of (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one (CID 138376730) is (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one.
What is the SMILES notation for (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one?
The canonical SMILES for (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one is [H]/N=C1\NC(=O)S\C1=C/c1ccc(-c2nc3ccccc3s2)o1.
What is the InChIKey of (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one?
The InChIKey is RTBWHMVFOMMXTE-GHXNOFRVSA-N. The full InChI is InChI=1S/C15H9N3O2S2/c16-13-12(22-15(19)18-13)7-8-5-6-10(20-8)14-17-9-3-1-2-4-11(9)21-14/h1-7H,(H2,16,18,19)/b12-7-.
What are the key properties of (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one?
(5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one has a molecular weight of 327.39 g/mol, XLogP of 4.33, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methylidene]-4-imino-1,3-thiazolidin-2-one is sourced from PubChem (CID 138376730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).