About 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole
4-(azidomethyl)-5-cyclopropyl-1,3-oxazole (PubChem CID 138376786) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole |
| PubChem CID | 138376786 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole |
| SMILES | [N-]=[N+]=NCc1ncoc1C1CC1 |
| InChI | InChI=1S/C7H8N4O/c8-11-10-3-6-7(5-1-2-5)12-4-9-6/h4-5H,1-3H2 |
| InChIKey | NGGUUYXSTPAWQZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole?
The IUPAC name of 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole (CID 138376786) is 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole.
What is the SMILES notation for 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole?
The canonical SMILES for 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole is [N-]=[N+]=NCc1ncoc1C1CC1.
What is the InChIKey of 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole?
The InChIKey is NGGUUYXSTPAWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c8-11-10-3-6-7(5-1-2-5)12-4-9-6/h4-5H,1-3H2.
What are the key properties of 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole?
4-(azidomethyl)-5-cyclopropyl-1,3-oxazole has a molecular weight of 164.17 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)-5-cyclopropyl-1,3-oxazole is sourced from PubChem (CID 138376786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).