About 5H-pyrido[3,2-d][1,2,3]benzotriazepine
5H-pyrido[3,2-d][1,2,3]benzotriazepine (PubChem CID 138376835) has the molecular formula C11H8N4
and a molecular weight of 196.21 g/mol. Its IUPAC name is 5H-pyrido[3,2-d][1,2,3]benzotriazepine.
Molecular Properties
| Compound Name | 5H-pyrido[3,2-d][1,2,3]benzotriazepine |
| PubChem CID | 138376835 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 5H-pyrido[3,2-d][1,2,3]benzotriazepine |
| SMILES | c1ccc2c(c1)N=NNc1cccnc1-2 |
| InChI | InChI=1S/C11H8N4/c1-2-5-9-8(4-1)11-10(14-15-13-9)6-3-7-12-11/h1-7H,(H,13,14) |
| InChIKey | QJQBEFDBDBWYHZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-pyrido[3,2-d][1,2,3]benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrido[3,2-d][1,2,3]benzotriazepine?
The IUPAC name of 5H-pyrido[3,2-d][1,2,3]benzotriazepine (CID 138376835) is 5H-pyrido[3,2-d][1,2,3]benzotriazepine.
What is the SMILES notation for 5H-pyrido[3,2-d][1,2,3]benzotriazepine?
The canonical SMILES for 5H-pyrido[3,2-d][1,2,3]benzotriazepine is c1ccc2c(c1)N=NNc1cccnc1-2.
What is the InChIKey of 5H-pyrido[3,2-d][1,2,3]benzotriazepine?
The InChIKey is QJQBEFDBDBWYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4/c1-2-5-9-8(4-1)11-10(14-15-13-9)6-3-7-12-11/h1-7H,(H,13,14).
What are the key properties of 5H-pyrido[3,2-d][1,2,3]benzotriazepine?
5H-pyrido[3,2-d][1,2,3]benzotriazepine has a molecular weight of 196.21 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrido[3,2-d][1,2,3]benzotriazepine is sourced from PubChem (CID 138376835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).