About 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide
4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide (PubChem CID 138377014) has the molecular formula C10H7Cl2N3O3S2
and a molecular weight of 352.22 g/mol. Its IUPAC name is 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide |
| PubChem CID | 138377014 |
| Molecular Formula | C10H7Cl2N3O3S2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2nsc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C10H7Cl2N3O3S2/c11-7-8(15-19-9(7)12)10(16)14-5-1-3-6(4-2-5)20(13,17)18/h1-4H,(H,14,16)(H2,13,17,18) |
| InChIKey | FSKBBOUZOIOXEW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide?
The IUPAC name of 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide (CID 138377014) is 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide?
The canonical SMILES for 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide is NS(=O)(=O)c1ccc(NC(=O)c2nsc(Cl)c2Cl)cc1.
What is the InChIKey of 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide?
The InChIKey is FSKBBOUZOIOXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3O3S2/c11-7-8(15-19-9(7)12)10(16)14-5-1-3-6(4-2-5)20(13,17)18/h1-4H,(H,14,16)(H2,13,17,18).
What are the key properties of 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide?
4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide has a molecular weight of 352.22 g/mol, XLogP of 2.35, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-N-(4-sulfamoylphenyl)-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 138377014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).