About ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate
ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate (PubChem CID 138377036) has the molecular formula C14H22N2O5
and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate |
| PubChem CID | 138377036 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncoc1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O5/c1-5-19-12(17)11-10(20-9-16-11)7-6-8-15-13(18)21-14(2,3)4/h9H,5-8H2,1-4H3,(H,15,18) |
| InChIKey | OUPODJXUWSOYPB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate (CID 138377036) is ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate is CCOC(=O)c1ncoc1CCCNC(=O)OC(C)(C)C.
What is the InChIKey of ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate?
The InChIKey is OUPODJXUWSOYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O5/c1-5-19-12(17)11-10(20-9-16-11)7-6-8-15-13(18)21-14(2,3)4/h9H,5-8H2,1-4H3,(H,15,18).
What are the key properties of ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate?
ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate has a molecular weight of 298.34 g/mol, XLogP of 2.31, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 138377036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).