About 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide
4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide (PubChem CID 138377180) has the molecular formula C16H10Cl2N4OS
and a molecular weight of 377.26 g/mol. Its IUPAC name is 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide |
| PubChem CID | 138377180 |
| Molecular Formula | C16H10Cl2N4OS |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)c1nsc(Cl)c1Cl |
| InChI | InChI=1S/C16H10Cl2N4OS/c17-13-14(22-24-15(13)18)16(23)19-10-6-8-12(9-7-10)21-20-11-4-2-1-3-5-11/h1-9H,(H,19,23)/b21-20+ |
| InChIKey | IWWJCDXSIAADAA-QZQOTICOSA-N |
| XLogP | 6.12 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide?
The IUPAC name of 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide (CID 138377180) is 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide?
The canonical SMILES for 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide is O=C(Nc1ccc(/N=N/c2ccccc2)cc1)c1nsc(Cl)c1Cl.
What is the InChIKey of 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide?
The InChIKey is IWWJCDXSIAADAA-QZQOTICOSA-N. The full InChI is InChI=1S/C16H10Cl2N4OS/c17-13-14(22-24-15(13)18)16(23)19-10-6-8-12(9-7-10)21-20-11-4-2-1-3-5-11/h1-9H,(H,19,23)/b21-20+.
What are the key properties of 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide?
4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide has a molecular weight of 377.26 g/mol, XLogP of 6.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-N-(4-phenyldiazenylphenyl)-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 138377180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).