C20H14Cl2N2O4S — CID 138377321
1-(4-chlorophenyl)-3-[[5-[2-(4-chlorophenyl)ethenyl]-1,3,4-oxadiazol-2-yl]methylsulfonyl]prop-2-en-1-one (PubChem CID 138377321) has the molecular formula C20H14Cl2N2O4S and a molecular weight of 449.32 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[5-[2-(4-chlorophenyl)ethenyl]-1,3,4-oxadiazol-2-yl]methylsulfonyl]prop-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-[[5-[2-(4-chlorophenyl)ethenyl]-1,3,4-oxadiazol-2-yl]methylsulfonyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 138377321 |
| Molecular Formula | C20H14Cl2N2O4S |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[5-[2-(4-chlorophenyl)ethenyl]-1,3,4-oxadiazol-2-yl]methylsulfonyl]prop-2-en-1-one |
| SMILES | O=C(C=CS(=O)(=O)Cc1nnc(C=Cc2ccc(Cl)cc2)o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl2N2O4S/c21-16-6-1-14(2-7-16)3-10-19-23-24-20(28-19)13-29(26,27)12-11-18(25)15-4-8-17(22)9-5-15/h1-12H,13H2 |
| InChIKey | BHULLXBVOAWOEH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|