About 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one
4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one (PubChem CID 138377544) has the molecular formula C4H2N2OS2
and a molecular weight of 158.21 g/mol. Its IUPAC name is 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one.
Molecular Properties
| Compound Name | 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one |
| PubChem CID | 138377544 |
| Molecular Formula | C4H2N2OS2 |
| Molecular Weight | 158.21 g/mol |
| Exact Mass | 157.96 |
| IUPAC Name | 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one |
| SMILES | O=c1[nH]c2ncsc2s1 |
| InChI | InChI=1S/C4H2N2OS2/c7-4-6-2-3(9-4)8-1-5-2/h1H,(H,6,7) |
| InChIKey | UTISHWQDRKQYOB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one?
The IUPAC name of 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one (CID 138377544) is 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one.
What is the SMILES notation for 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one?
The canonical SMILES for 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one is O=c1[nH]c2ncsc2s1.
What is the InChIKey of 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one?
The InChIKey is UTISHWQDRKQYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2OS2/c7-4-6-2-3(9-4)8-1-5-2/h1H,(H,6,7).
What are the key properties of 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one?
4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one has a molecular weight of 158.21 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-[1,3]thiazolo[4,5-d][1,3]thiazol-5-one is sourced from PubChem (CID 138377544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).