C12H13Cl2NO3S — CID 138377898
(1S,5R,6R)-3-(2,4-dichlorophenyl)sulfonyl-3-azabicyclo[3.2.0]heptan-6-ol (PubChem CID 138377898) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is (1S,5R,6R)-3-(2,4-dichlorophenyl)sulfonyl-3-azabicyclo[3.2.0]heptan-6-ol.
| Compound Name | (1S,5R,6R)-3-(2,4-dichlorophenyl)sulfonyl-3-azabicyclo[3.2.0]heptan-6-ol |
|---|---|
| PubChem CID | 138377898 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (1S,5R,6R)-3-(2,4-dichlorophenyl)sulfonyl-3-azabicyclo[3.2.0]heptan-6-ol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1Cl)N1C[C@H]2C[C@@H](O)[C@H]2C1 |
| InChI | InChI=1S/C12H13Cl2NO3S/c13-8-1-2-12(10(14)4-8)19(17,18)15-5-7-3-11(16)9(7)6-15/h1-2,4,7,9,11,16H,3,5-6H2/t7-,9+,11-/m1/s1 |
| InChIKey | LCDYVOFELUDPIA-POZPLHJXSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |