C21H21N5O — CID 138379736
4-[4-[1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)imidazol-2-yl]phenyl]morpholine (PubChem CID 138379736) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[4-[1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)imidazol-2-yl]phenyl]morpholine.
| Compound Name | 4-[4-[1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)imidazol-2-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 138379736 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-[4-[1-(pyrazolo[1,5-a]pyridin-4-ylmethyl)imidazol-2-yl]phenyl]morpholine |
| SMILES | c1cc(Cn2ccnc2-c2ccc(N3CCOCC3)cc2)c2ccnn2c1 |
| InChI | InChI=1S/C21H21N5O/c1-2-18(20-7-8-23-26(20)10-1)16-25-11-9-22-21(25)17-3-5-19(6-4-17)24-12-14-27-15-13-24/h1-11H,12-16H2 |
| InChIKey | DBTNNTBJBHGXGG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|