About 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide
2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide (PubChem CID 138380561) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide |
| PubChem CID | 138380561 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(N2CC3C(C2)C3(CO)CO)c1 |
| InChI | InChI=1S/C13H17N3O3/c14-12(19)8-1-2-15-11(3-8)16-4-9-10(5-16)13(9,6-17)7-18/h1-3,9-10,17-18H,4-7H2,(H2,14,19) |
| InChIKey | VHZIFMQKAYYDKF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide?
The IUPAC name of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide (CID 138380561) is 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide.
What is the SMILES notation for 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide?
The canonical SMILES for 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide is NC(=O)c1ccnc(N2CC3C(C2)C3(CO)CO)c1.
What is the InChIKey of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide?
The InChIKey is VHZIFMQKAYYDKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c14-12(19)8-1-2-15-11(3-8)16-4-9-10(5-16)13(9,6-17)7-18/h1-3,9-10,17-18H,4-7H2,(H2,14,19).
What are the key properties of 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide?
2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide has a molecular weight of 263.30 g/mol, XLogP of -0.78, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,6-bis(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]pyridine-4-carboxamide is sourced from PubChem (CID 138380561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).