C17H25NO4 — CID 138380754
4-[4-(1-hydroxycyclopropyl)piperidine-1-carbonyl]-1-oxaspiro[4.4]nonan-2-one (PubChem CID 138380754) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[4-(1-hydroxycyclopropyl)piperidine-1-carbonyl]-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | 4-[4-(1-hydroxycyclopropyl)piperidine-1-carbonyl]-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 138380754 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-[4-(1-hydroxycyclopropyl)piperidine-1-carbonyl]-1-oxaspiro[4.4]nonan-2-one |
| SMILES | O=C1CC(C(=O)N2CCC(C3(O)CC3)CC2)C2(CCCC2)O1 |
| InChI | InChI=1S/C17H25NO4/c19-14-11-13(17(22-14)5-1-2-6-17)15(20)18-9-3-12(4-10-18)16(21)7-8-16/h12-13,21H,1-11H2 |
| InChIKey | YREJJEBWSCJPCR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |