C19H25ClN2O2 — CID 138382466
(3-chloro-4-pyrrolidin-1-ylphenyl)-[3-(1-hydroxycyclopropyl)piperidin-1-yl]methanone (PubChem CID 138382466) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is (3-chloro-4-pyrrolidin-1-ylphenyl)-[3-(1-hydroxycyclopropyl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-pyrrolidin-1-ylphenyl)-[3-(1-hydroxycyclopropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 138382466 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3-chloro-4-pyrrolidin-1-ylphenyl)-[3-(1-hydroxycyclopropyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(N2CCCC2)c(Cl)c1)N1CCCC(C2(O)CC2)C1 |
| InChI | InChI=1S/C19H25ClN2O2/c20-16-12-14(5-6-17(16)21-9-1-2-10-21)18(23)22-11-3-4-15(13-22)19(24)7-8-19/h5-6,12,15,24H,1-4,7-11,13H2 |
| InChIKey | VHQLETDPISSRNY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |