About [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone
[4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 138383090) has the molecular formula C17H21FN6O2S
and a molecular weight of 392.46 g/mol. Its IUPAC name is [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone |
| PubChem CID | 138383090 |
| Molecular Formula | C17H21FN6O2S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCCN(c2ncc(F)c(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C17H21FN6O2S/c18-13-10-19-17(21-15(13)22-6-8-26-9-7-22)24-3-1-2-23(4-5-24)16(25)14-11-27-12-20-14/h10-12H,1-9H2 |
| InChIKey | OSKIHJRQIVNWTB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone?
The IUPAC name of [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone (CID 138383090) is [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone?
The canonical SMILES for [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone is O=C(c1cscn1)N1CCCN(c2ncc(F)c(N3CCOCC3)n2)CC1.
What is the InChIKey of [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone?
The InChIKey is OSKIHJRQIVNWTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN6O2S/c18-13-10-19-17(21-15(13)22-6-8-26-9-7-22)24-3-1-2-23(4-5-24)16(25)14-11-27-12-20-14/h10-12H,1-9H2.
What are the key properties of [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone?
[4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone has a molecular weight of 392.46 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,4-diazepan-1-yl]-(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 138383090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).