About 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole
1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole (PubChem CID 138383649) has the molecular formula C19H21N7O
and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole.
Molecular Properties
| Compound Name | 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole |
| PubChem CID | 138383649 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole |
| SMILES | Cn1cc(-n2nc(C3CCOCC3)nc2-c2nn(C)c3ccccc23)cn1 |
| InChI | InChI=1S/C19H21N7O/c1-24-12-14(11-20-24)26-19(21-18(23-26)13-7-9-27-10-8-13)17-15-5-3-4-6-16(15)25(2)22-17/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | WXKSVMDWJLZJEZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole?
The IUPAC name of 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole (CID 138383649) is 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole.
What is the SMILES notation for 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole?
The canonical SMILES for 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole is Cn1cc(-n2nc(C3CCOCC3)nc2-c2nn(C)c3ccccc23)cn1.
What is the InChIKey of 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole?
The InChIKey is WXKSVMDWJLZJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N7O/c1-24-12-14(11-20-24)26-19(21-18(23-26)13-7-9-27-10-8-13)17-15-5-3-4-6-16(15)25(2)22-17/h3-6,11-13H,7-10H2,1-2H3.
What are the key properties of 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole?
1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole has a molecular weight of 363.43 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[2-(1-methylpyrazol-4-yl)-5-(oxan-4-yl)-1,2,4-triazol-3-yl]indazole is sourced from PubChem (CID 138383649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).