C17H28N4O — CID 138383936
(3aR,7aS)-2-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 138383936) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is (3aR,7aS)-2-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-2-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 138383936 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (3aR,7aS)-2-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | Cc1nn(C(C)C)c(C)c1CN1C[C@H]2CCN(C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C17H28N4O/c1-11(2)21-13(4)15(12(3)18-21)9-20-8-14-6-7-19(5)17(22)16(14)10-20/h11,14,16H,6-10H2,1-5H3/t14-,16+/m1/s1 |
| InChIKey | RJZAASYOOMWVJP-ZBFHGGJFSA-N |
| XLogP | 1.99 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |