C18H25N3O4S — CID 138384588
N-[2-[(3aR,7aS)-5-methyl-4-oxo-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide (PubChem CID 138384588) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[2-[(3aR,7aS)-5-methyl-4-oxo-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-[2-[(3aR,7aS)-5-methyl-4-oxo-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 138384588 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-[(3aR,7aS)-5-methyl-4-oxo-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-2-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide |
| SMILES | Cc1cccc(N(CC(=O)N2C[C@H]3CCN(C)C(=O)[C@H]3C2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H25N3O4S/c1-13-5-4-6-15(9-13)21(26(3,24)25)12-17(22)20-10-14-7-8-19(2)18(23)16(14)11-20/h4-6,9,14,16H,7-8,10-12H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | ONNDTGXUJATGRP-ZBFHGGJFSA-N |
| XLogP | 0.70 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |