C12H12N6O3 — CID 138385422
2-(2,5-dioxoimidazolidin-1-yl)-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)acetamide (PubChem CID 138385422) has the molecular formula C12H12N6O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 138385422 |
| Molecular Formula | C12H12N6O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(2H-pyrazolo[3,4-b]pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)CNC1=O)NCc1[nH]nc2ncccc12 |
| InChI | InChI=1S/C12H12N6O3/c19-9(6-18-10(20)5-15-12(18)21)14-4-8-7-2-1-3-13-11(7)17-16-8/h1-3H,4-6H2,(H,14,19)(H,15,21)(H,13,16,17) |
| InChIKey | NMWGOJAZMOBBLM-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|