C14H19F3N2O — CID 138385731
4-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]-1H-pyridin-2-one (PubChem CID 138385731) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]-1H-pyridin-2-one.
| Compound Name | 4-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 138385731 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-[1-(4,4,4-trifluorobutyl)piperidin-4-yl]-1H-pyridin-2-one |
| SMILES | O=c1cc(C2CCN(CCCC(F)(F)F)CC2)cc[nH]1 |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)5-1-7-19-8-3-11(4-9-19)12-2-6-18-13(20)10-12/h2,6,10-11H,1,3-5,7-9H2,(H,18,20) |
| InChIKey | WVTNXOVFFDFRIZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |