About 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one
5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one (PubChem CID 138385825) has the molecular formula C20H33N3O2
and a molecular weight of 347.50 g/mol. Its IUPAC name is 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one |
| PubChem CID | 138385825 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one |
| SMILES | CC(C)(CN1CCOCC1)CN1CCC(Cc2ccc(=O)[nH]c2)CC1 |
| InChI | InChI=1S/C20H33N3O2/c1-20(2,16-23-9-11-25-12-10-23)15-22-7-5-17(6-8-22)13-18-3-4-19(24)21-14-18/h3-4,14,17H,5-13,15-16H2,1-2H3,(H,21,24) |
| InChIKey | MIRPBOBUZUMVSU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one?
The IUPAC name of 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one (CID 138385825) is 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one.
What is the SMILES notation for 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one?
The canonical SMILES for 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one is CC(C)(CN1CCOCC1)CN1CCC(Cc2ccc(=O)[nH]c2)CC1.
What is the InChIKey of 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one?
The InChIKey is MIRPBOBUZUMVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N3O2/c1-20(2,16-23-9-11-25-12-10-23)15-22-7-5-17(6-8-22)13-18-3-4-19(24)21-14-18/h3-4,14,17H,5-13,15-16H2,1-2H3,(H,21,24).
What are the key properties of 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one?
5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one has a molecular weight of 347.50 g/mol, XLogP of 1.99, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[1-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperidin-4-yl]methyl]-1H-pyridin-2-one is sourced from PubChem (CID 138385825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).