C15H16F3N3O2 — CID 138386078
4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-(trifluoromethoxy)phenol (PubChem CID 138386078) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-(trifluoromethoxy)phenol.
| Compound Name | 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 138386078 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-(trifluoromethoxy)phenol |
| SMILES | Oc1ccc(-c2n[nH]c(C3CCCCC3)n2)cc1OC(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O2/c16-15(17,18)23-12-8-10(6-7-11(12)22)14-19-13(20-21-14)9-4-2-1-3-5-9/h6-9,22H,1-5H2,(H,19,20,21) |
| InChIKey | KXZHTUWEUDXJGM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |