C16H24N4O2 — CID 138386129
N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 138386129) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 138386129 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | Cc1nc(C)c(CC(=O)N[C@H]2CCCN3CCC[C@@H]23)c(=O)[nH]1 |
| InChI | InChI=1S/C16H24N4O2/c1-10-12(16(22)18-11(2)17-10)9-15(21)19-13-5-3-7-20-8-4-6-14(13)20/h13-14H,3-9H2,1-2H3,(H,19,21)(H,17,18,22)/t13-,14-/m0/s1 |
| InChIKey | DEMQURDYNBDILU-KBPBESRZSA-N |
| XLogP | 0.67 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |