C17H25N3OS — CID 138386952
[4-(cyclohex-3-en-1-ylmethyl)-1,4-diazepan-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 138386952) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is [4-(cyclohex-3-en-1-ylmethyl)-1,4-diazepan-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [4-(cyclohex-3-en-1-ylmethyl)-1,4-diazepan-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 138386952 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [4-(cyclohex-3-en-1-ylmethyl)-1,4-diazepan-1-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CCCN(CC3CC=CCC3)CC2)cs1 |
| InChI | InChI=1S/C17H25N3OS/c1-14-18-16(13-22-14)17(21)20-9-5-8-19(10-11-20)12-15-6-3-2-4-7-15/h2-3,13,15H,4-12H2,1H3 |
| InChIKey | OMENWDWFYXMVMJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|