C21H26N6O — CID 138387199
4-methyl-5-[2-(oxolan-3-yl)-5-pentyl-1,2,4-triazol-3-yl]-2-pyridin-3-ylpyrimidine (PubChem CID 138387199) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-methyl-5-[2-(oxolan-3-yl)-5-pentyl-1,2,4-triazol-3-yl]-2-pyridin-3-ylpyrimidine.
| Compound Name | 4-methyl-5-[2-(oxolan-3-yl)-5-pentyl-1,2,4-triazol-3-yl]-2-pyridin-3-ylpyrimidine |
|---|---|
| PubChem CID | 138387199 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-methyl-5-[2-(oxolan-3-yl)-5-pentyl-1,2,4-triazol-3-yl]-2-pyridin-3-ylpyrimidine |
| SMILES | CCCCCc1nc(-c2cnc(-c3cccnc3)nc2C)n(C2CCOC2)n1 |
| InChI | InChI=1S/C21H26N6O/c1-3-4-5-8-19-25-21(27(26-19)17-9-11-28-14-17)18-13-23-20(24-15(18)2)16-7-6-10-22-12-16/h6-7,10,12-13,17H,3-5,8-9,11,14H2,1-2H3 |
| InChIKey | COFSJAXKBSNOSR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|