C23H31N3O3 — CID 138387502
2-[[2-butyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 138387502) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[[2-butyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[[2-butyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 138387502 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-[[2-butyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | CCCCN1CC2CN(Cc3nc(C(=O)O)co3)CC2(CCc2ccccc2)C1 |
| InChI | InChI=1S/C23H31N3O3/c1-2-3-11-25-12-19-13-26(14-21-24-20(15-29-21)22(27)28)17-23(19,16-25)10-9-18-7-5-4-6-8-18/h4-8,15,19H,2-3,9-14,16-17H2,1H3,(H,27,28) |
| InChIKey | YRPAQMBGVZNZQX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |