C11H13N3O3 — CID 138388367
4-(2,4-dimethoxyphenyl)-5-iminoimidazolidin-2-one (PubChem CID 138388367) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-5-iminoimidazolidin-2-one.
| Compound Name | 4-(2,4-dimethoxyphenyl)-5-iminoimidazolidin-2-one |
|---|---|
| PubChem CID | 138388367 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-5-iminoimidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)NC1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C11H13N3O3/c1-16-6-3-4-7(8(5-6)17-2)9-10(12)14-11(15)13-9/h3-5,9H,1-2H3,(H3,12,13,14,15) |
| InChIKey | UVDZCEXXZBEQAG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|