C16H23N3O2 — CID 138388652
4-imino-5-[(4-methoxyphenyl)methyl]-5-methyl-1-(2-methylpropyl)imidazolidin-2-one (PubChem CID 138388652) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-imino-5-[(4-methoxyphenyl)methyl]-5-methyl-1-(2-methylpropyl)imidazolidin-2-one.
| Compound Name | 4-imino-5-[(4-methoxyphenyl)methyl]-5-methyl-1-(2-methylpropyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 138388652 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-imino-5-[(4-methoxyphenyl)methyl]-5-methyl-1-(2-methylpropyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC(C)C)C1(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-11(2)10-19-15(20)18-14(17)16(19,3)9-12-5-7-13(21-4)8-6-12/h5-8,11H,9-10H2,1-4H3,(H2,17,18,20) |
| InChIKey | YEZJHZFGJIXSLZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|