About 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one
4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138388673) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one |
| PubChem CID | 138388673 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C12CCCC(C)C2C |
| InChI | InChI=1S/C13H23N3O/c1-4-8-16-12(17)15-11(14)13(16)7-5-6-9(2)10(13)3/h9-10H,4-8H2,1-3H3,(H2,14,15,17) |
| InChIKey | FLENIGOWAQJHFZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one?
The IUPAC name of 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one (CID 138388673) is 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one.
What is the SMILES notation for 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one?
The canonical SMILES for 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one is [H]/N=C1\NC(=O)N(CCC)C12CCCC(C)C2C.
What is the InChIKey of 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one?
The InChIKey is FLENIGOWAQJHFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-4-8-16-12(17)15-11(14)13(16)7-5-6-9(2)10(13)3/h9-10H,4-8H2,1-3H3,(H2,14,15,17).
What are the key properties of 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one?
4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one has a molecular weight of 237.35 g/mol, XLogP of 2.59, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-6,7-dimethyl-1-propyl-1,3-diazaspiro[4.5]decan-2-one is sourced from PubChem (CID 138388673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).