C11H13N3O3 — CID 138389362
5-(3,4-dihydroxyphenyl)-1-ethyl-4-iminoimidazolidin-2-one (PubChem CID 138389362) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-(3,4-dihydroxyphenyl)-1-ethyl-4-iminoimidazolidin-2-one.
| Compound Name | 5-(3,4-dihydroxyphenyl)-1-ethyl-4-iminoimidazolidin-2-one |
|---|---|
| PubChem CID | 138389362 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-(3,4-dihydroxyphenyl)-1-ethyl-4-iminoimidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC)C1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H13N3O3/c1-2-14-9(10(12)13-11(14)17)6-3-4-7(15)8(16)5-6/h3-5,9,15-16H,2H2,1H3,(H2,12,13,17) |
| InChIKey | MIWSXSIHIGPBBL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|