C13H13N3OS — CID 138390230
5-(1-benzothiophen-3-yl)-1-ethyl-4-iminoimidazolidin-2-one (PubChem CID 138390230) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-(1-benzothiophen-3-yl)-1-ethyl-4-iminoimidazolidin-2-one.
| Compound Name | 5-(1-benzothiophen-3-yl)-1-ethyl-4-iminoimidazolidin-2-one |
|---|---|
| PubChem CID | 138390230 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-(1-benzothiophen-3-yl)-1-ethyl-4-iminoimidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC)C1c1csc2ccccc12 |
| InChI | InChI=1S/C13H13N3OS/c1-2-16-11(12(14)15-13(16)17)9-7-18-10-6-4-3-5-8(9)10/h3-7,11H,2H2,1H3,(H2,14,15,17) |
| InChIKey | AMBCPCFXVNYDMI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|