C12H13Cl2N3O2 — CID 138390703
5-(2,6-dichlorophenyl)-4-imino-1-(2-methoxyethyl)imidazolidin-2-one (PubChem CID 138390703) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-4-imino-1-(2-methoxyethyl)imidazolidin-2-one.
| Compound Name | 5-(2,6-dichlorophenyl)-4-imino-1-(2-methoxyethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 138390703 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-4-imino-1-(2-methoxyethyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CCOC)C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O2/c1-19-6-5-17-10(11(15)16-12(17)18)9-7(13)3-2-4-8(9)14/h2-4,10H,5-6H2,1H3,(H2,15,16,18) |
| InChIKey | WXBDFBRXKRYGMG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|