C14H16BrN3O — CID 138391298
6-bromo-4'-imino-1'-propylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one (PubChem CID 138391298) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is 6-bromo-4'-imino-1'-propylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one.
| Compound Name | 6-bromo-4'-imino-1'-propylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 138391298 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 6-bromo-4'-imino-1'-propylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C12CCc1cc(Br)ccc12 |
| InChI | InChI=1S/C14H16BrN3O/c1-2-7-18-13(19)17-12(16)14(18)6-5-9-8-10(15)3-4-11(9)14/h3-4,8H,2,5-7H2,1H3,(H2,16,17,19) |
| InChIKey | DRRIDWJYYFGAJE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|