About 2-imino-1,5,5-trimethylimidazolidin-4-one
2-imino-1,5,5-trimethylimidazolidin-4-one (PubChem CID 138391490) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-imino-1,5,5-trimethylimidazolidin-4-one.
Molecular Properties
| Compound Name | 2-imino-1,5,5-trimethylimidazolidin-4-one |
| PubChem CID | 138391490 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 2-imino-1,5,5-trimethylimidazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(C)(C)N1C |
| InChI | InChI=1S/C6H11N3O/c1-6(2)4(10)8-5(7)9(6)3/h1-3H3,(H2,7,8,10) |
| InChIKey | CDSHTMPNUBQEMW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-1,5,5-trimethylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-1,5,5-trimethylimidazolidin-4-one?
The IUPAC name of 2-imino-1,5,5-trimethylimidazolidin-4-one (CID 138391490) is 2-imino-1,5,5-trimethylimidazolidin-4-one.
What is the SMILES notation for 2-imino-1,5,5-trimethylimidazolidin-4-one?
The canonical SMILES for 2-imino-1,5,5-trimethylimidazolidin-4-one is [H]/N=C1\NC(=O)C(C)(C)N1C.
What is the InChIKey of 2-imino-1,5,5-trimethylimidazolidin-4-one?
The InChIKey is CDSHTMPNUBQEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-6(2)4(10)8-5(7)9(6)3/h1-3H3,(H2,7,8,10).
What are the key properties of 2-imino-1,5,5-trimethylimidazolidin-4-one?
2-imino-1,5,5-trimethylimidazolidin-4-one has a molecular weight of 141.17 g/mol, XLogP of -0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-1,5,5-trimethylimidazolidin-4-one is sourced from PubChem (CID 138391490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).