C24H28N2O3S — CID 138391568
[4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]-[(1R)-2-thiophen-2-ylcyclopropyl]methanone (PubChem CID 138391568) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is [4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]-[(1R)-2-thiophen-2-ylcyclopropyl]methanone.
| Compound Name | [4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]-[(1R)-2-thiophen-2-ylcyclopropyl]methanone |
|---|---|
| PubChem CID | 138391568 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [4-(4-phenyloxane-4-carbonyl)piperazin-1-yl]-[(1R)-2-thiophen-2-ylcyclopropyl]methanone |
| SMILES | O=C([C@@H]1CC1c1cccs1)N1CCN(C(=O)C2(c3ccccc3)CCOCC2)CC1 |
| InChI | InChI=1S/C24H28N2O3S/c27-22(20-17-19(20)21-7-4-16-30-21)25-10-12-26(13-11-25)23(28)24(8-14-29-15-9-24)18-5-2-1-3-6-18/h1-7,16,19-20H,8-15,17H2/t19?,20-/m1/s1 |
| InChIKey | LUQMEBVOJGTUPZ-GFOWMXPYSA-N |
| XLogP | 3.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |