C22H21NO2 — CID 138391814
(3aS,7aR)-3-benzyl-7a-(2-phenylethynyl)-4,5,6,7-tetrahydro-3aH-1,3-benzoxazol-2-one (PubChem CID 138391814) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3aS,7aR)-3-benzyl-7a-(2-phenylethynyl)-4,5,6,7-tetrahydro-3aH-1,3-benzoxazol-2-one.
| Compound Name | (3aS,7aR)-3-benzyl-7a-(2-phenylethynyl)-4,5,6,7-tetrahydro-3aH-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 138391814 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3aS,7aR)-3-benzyl-7a-(2-phenylethynyl)-4,5,6,7-tetrahydro-3aH-1,3-benzoxazol-2-one |
| SMILES | O=C1O[C@@]2(C#Cc3ccccc3)CCCC[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H21NO2/c24-21-23(17-19-11-5-2-6-12-19)20-13-7-8-15-22(20,25-21)16-14-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13,15,17H2/t20-,22+/m0/s1 |
| InChIKey | VQTUROFPFVPFHZ-RBBKRZOGSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|